C20H25N5O5S — CID 55601871
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate (PubChem CID 55601871) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 55601871 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)C2CCCCN2c2ncccn2)cc1 |
| InChI | InChI=1S/C20H25N5O5S/c21-31(28,29)16-7-5-15(6-8-16)9-12-22-18(26)14-30-19(27)17-4-1-2-13-25(17)20-23-10-3-11-24-20/h3,5-8,10-11,17H,1-2,4,9,12-14H2,(H,22,26)(H2,21,28,29) |
| InChIKey | KSQQEKHSTMGIIU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |