C19H21ClN4O3 — CID 55601875
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate (PubChem CID 55601875) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 55601875 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-2-carboxylate |
| SMILES | O=C(COC(=O)C1CCCCN1c1ncccn1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN4O3/c20-15-7-5-14(6-8-15)12-23-17(25)13-27-18(26)16-4-1-2-11-24(16)19-21-9-3-10-22-19/h3,5-10,16H,1-2,4,11-13H2,(H,23,25) |
| InChIKey | DQLBKMOVICGCTF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |