C17H19N3O3S — CID 38483346
[2-(5-methylthiophen-2-yl)-2-oxoethyl] (2R)-1-pyrimidin-2-ylpiperidine-2-carboxylate (PubChem CID 38483346) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] (2R)-1-pyrimidin-2-ylpiperidine-2-carboxylate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] (2R)-1-pyrimidin-2-ylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 38483346 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] (2R)-1-pyrimidin-2-ylpiperidine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)[C@H]2CCCCN2c2ncccn2)s1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12-6-7-15(24-12)14(21)11-23-16(22)13-5-2-3-10-20(13)17-18-8-4-9-19-17/h4,6-9,13H,2-3,5,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | OJYWQBOXEFXRIP-CYBMUJFWSA-N |
| XLogP | 2.63 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |