C22H29N3O3S — CID 55602261
N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-propyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide (PubChem CID 55602261) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-propyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-propyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
|---|---|
| PubChem CID | 55602261 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-propyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
| SMILES | CCCN(C(=O)c1nc(-c2ccccc2)n2c1CCCCC2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H29N3O3S/c1-2-13-24(18-12-15-29(27,28)16-18)22(26)20-19-11-7-4-8-14-25(19)21(23-20)17-9-5-3-6-10-17/h3,5-6,9-10,18H,2,4,7-8,11-16H2,1H3 |
| InChIKey | FJHVFYYOHCZJLD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |