C17H26N4O4S — CID 109072301
1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-3-N-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109072301) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-3-N-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-3-N-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109072301 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-3-N-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCNC(=O)c1nc(C(=O)N(C)C2CCS(=O)(=O)C2)c2n1CCCC2 |
| InChI | InChI=1S/C17H26N4O4S/c1-3-8-18-16(22)15-19-14(13-6-4-5-9-21(13)15)17(23)20(2)12-7-10-26(24,25)11-12/h12H,3-11H2,1-2H3,(H,18,22) |
| InChIKey | UHOCDLZRWOJWGS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |