C16H24N4O5S3 — CID 55602524
ethyl N-[5-[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55602524) has the molecular formula C16H24N4O5S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is ethyl N-[5-[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55602524 |
| Molecular Formula | C16H24N4O5S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | ethyl N-[5-[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)N(C2CCCC2)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C16H24N4O5S3/c1-2-25-15(22)17-14-18-19-16(27-14)26-9-13(21)20(11-5-3-4-6-11)12-7-8-28(23,24)10-12/h11-12H,2-10H2,1H3,(H,17,18,22) |
| InChIKey | AWBMKVMFCCVXAJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|