C13H20N4O5S3 — CID 55640245
ethyl N-[5-[1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55640245) has the molecular formula C13H20N4O5S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is ethyl N-[5-[1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55640245 |
| Molecular Formula | C13H20N4O5S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl N-[5-[1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SC(C)C(=O)N(C)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C13H20N4O5S3/c1-4-22-12(19)14-11-15-16-13(24-11)23-8(2)10(18)17(3)9-5-6-25(20,21)7-9/h8-9H,4-7H2,1-3H3,(H,14,15,19) |
| InChIKey | KXOBTTJKANUFGI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|