C22H28N2O2 — CID 55602806
2-(4-tert-butylphenoxy)-N-cyclopropyl-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 55602806) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-cyclopropyl-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-cyclopropyl-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55602806 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-cyclopropyl-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)N(Cc1ccncc1)C1CC1 |
| InChI | InChI=1S/C22H28N2O2/c1-16(26-20-9-5-18(6-10-20)22(2,3)4)21(25)24(19-7-8-19)15-17-11-13-23-14-12-17/h5-6,9-14,16,19H,7-8,15H2,1-4H3 |
| InChIKey | XARILZSYDWBMGT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |