C18H33N3O5 — CID 55603155
tert-butyl N-[3-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-3-oxopropyl]carbamate (PubChem CID 55603155) has the molecular formula C18H33N3O5 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 55603155 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | tert-butyl N-[3-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C18H33N3O5/c1-18(2,3)26-17(23)19-6-4-16(22)20-12-15(14-5-9-25-13-14)21-7-10-24-11-8-21/h14-15H,4-13H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | IOPUTZGUVMJXOO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |