C19H35N3O5 — CID 55603240
tert-butyl N-[4-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-4-oxobutyl]carbamate (PubChem CID 55603240) has the molecular formula C19H35N3O5 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55603240 |
| Molecular Formula | C19H35N3O5 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl N-[4-[[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C19H35N3O5/c1-19(2,3)27-18(24)20-7-4-5-17(23)21-13-16(15-6-10-26-14-15)22-8-11-25-12-9-22/h15-16H,4-14H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | YIPCPZZCKMSMBG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|