C20H18FN3O4 — CID 55607622
1-(2-fluoro-4-methylphenyl)-4-(5-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (PubChem CID 55607622) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-4-(5-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-4-(5-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 55607622 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-4-(5-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC(C(=O)N3CCc4cc([N+](=O)[O-])ccc43)CC2=O)c(F)c1 |
| InChI | InChI=1S/C20H18FN3O4/c1-12-2-4-18(16(21)8-12)23-11-14(10-19(23)25)20(26)22-7-6-13-9-15(24(27)28)3-5-17(13)22/h2-5,8-9,14H,6-7,10-11H2,1H3 |
| InChIKey | RRHIPGHRMRHWSP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|