C20H18BrN3O4 — CID 55580429
1-(4-bromo-3-methylphenyl)-4-(6-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (PubChem CID 55580429) has the molecular formula C20H18BrN3O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-4-(6-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(4-bromo-3-methylphenyl)-4-(6-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 55580429 |
| Molecular Formula | C20H18BrN3O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-4-(6-nitro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1cc(N2CC(C(=O)N3CCc4ccc([N+](=O)[O-])cc43)CC2=O)ccc1Br |
| InChI | InChI=1S/C20H18BrN3O4/c1-12-8-15(4-5-17(12)21)23-11-14(9-19(23)25)20(26)22-7-6-13-2-3-16(24(27)28)10-18(13)22/h2-5,8,10,14H,6-7,9,11H2,1H3 |
| InChIKey | PMFOZEYQTSVEQB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|