C20H17BrFN3O4 — CID 167809989
4-(6-bromo-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one (PubChem CID 167809989) has the molecular formula C20H17BrFN3O4 and a molecular weight of 462.28 g/mol. Its IUPAC name is 4-(6-bromo-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-(6-bromo-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 167809989 |
| Molecular Formula | C20H17BrFN3O4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 4-(6-bromo-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCCc3cc(Br)ccc32)CN1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17BrFN3O4/c21-14-3-6-17-12(8-14)2-1-7-23(17)20(27)13-9-19(26)24(11-13)15-4-5-16(22)18(10-15)25(28)29/h3-6,8,10,13H,1-2,7,9,11H2 |
| InChIKey | ALHUPMLDNFVNCF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|