C22H22FN3O4 — CID 166206560
4-(8-ethyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one (PubChem CID 166206560) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is 4-(8-ethyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-(8-ethyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 166206560 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(8-ethyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
| SMILES | CCc1cccc2c1N(C(=O)C1CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C1)CCC2 |
| InChI | InChI=1S/C22H22FN3O4/c1-2-14-5-3-6-15-7-4-10-24(21(14)15)22(28)16-11-20(27)25(13-16)17-8-9-18(23)19(12-17)26(29)30/h3,5-6,8-9,12,16H,2,4,7,10-11,13H2,1H3 |
| InChIKey | MAJGHYZGAUUYFZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|