C19H26FN5O6S — CID 55571165
N,N-diethyl-4-[1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-sulfonamide (PubChem CID 55571165) has the molecular formula C19H26FN5O6S and a molecular weight of 471.51 g/mol. Its IUPAC name is N,N-diethyl-4-[1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-[1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55571165 |
| Molecular Formula | C19H26FN5O6S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N,N-diethyl-4-[1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)CC1 |
| InChI | InChI=1S/C19H26FN5O6S/c1-3-22(4-2)32(30,31)23-9-7-21(8-10-23)19(27)14-11-18(26)24(13-14)15-5-6-16(20)17(12-15)25(28)29/h5-6,12,14H,3-4,7-11,13H2,1-2H3 |
| InChIKey | WPUDSQDCRFRFKV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 124.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|