C20H18Cl2FN5O4 — CID 55807852
4-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one (PubChem CID 55807852) has the molecular formula C20H18Cl2FN5O4 and a molecular weight of 482.30 g/mol. Its IUPAC name is 4-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 55807852 |
| Molecular Formula | C20H18Cl2FN5O4 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 4-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1)N1CCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H18Cl2FN5O4/c21-13-8-15(22)19(24-10-13)25-3-5-26(6-4-25)20(30)12-7-18(29)27(11-12)14-1-2-16(23)17(9-14)28(31)32/h1-2,8-10,12H,3-7,11H2 |
| InChIKey | NZZAJBMNCXTOIW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|