C19H17FN4O4 — CID 167784016
4-(3,4-dihydro-2H-1,6-naphthyridine-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one (PubChem CID 167784016) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,6-naphthyridine-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-(3,4-dihydro-2H-1,6-naphthyridine-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 167784016 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,6-naphthyridine-1-carbonyl)-1-(4-fluoro-3-nitrophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCCc3cnccc32)CN1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17FN4O4/c20-15-4-3-14(9-17(15)24(27)28)23-11-13(8-18(23)25)19(26)22-7-1-2-12-10-21-6-5-16(12)22/h3-6,9-10,13H,1-2,7-8,11H2 |
| InChIKey | XKWUTLKZKBUKMX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|