C29H31N3O3 — CID 55607859
N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55607859) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55607859 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[2-[(4-methylphenyl)methylcarbamoyl]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)C2CCCN(C(=O)Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-21-13-15-23(16-14-21)19-30-29(35)25-11-5-6-12-26(25)31-28(34)24-10-7-17-32(20-24)27(33)18-22-8-3-2-4-9-22/h2-6,8-9,11-16,24H,7,10,17-20H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | ZTBWUZFZYCGSOV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |