C20H20N6O4S — CID 55608059
N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 55608059) has the molecular formula C20H20N6O4S and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 55608059 |
| Molecular Formula | C20H20N6O4S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)Nc2cccc(-c3nnnn3C3CC3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O4S/c1-30-18-8-5-13(9-17(18)26(28)29)11-31-12-19(27)21-15-4-2-3-14(10-15)20-22-23-24-25(20)16-6-7-16/h2-5,8-10,16H,6-7,11-12H2,1H3,(H,21,27) |
| InChIKey | KQJADMHHCBJPDM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|