C22H25N3O5S — CID 55608393
methyl 3-[benzyl-[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]propanoate (PubChem CID 55608393) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is methyl 3-[benzyl-[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55608393 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 3-[benzyl-[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)Cn1c(CS(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C22H25N3O5S/c1-30-22(27)12-13-24(14-17-8-4-3-5-9-17)21(26)15-25-19-11-7-6-10-18(19)23-20(25)16-31(2,28)29/h3-11H,12-16H2,1-2H3 |
| InChIKey | QUYYYMHDNNFDRL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |