C24H30N4O3S — CID 46662294
N-methyl-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 46662294) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-methyl-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | N-methyl-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46662294 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-methyl-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)Cn1c(CS(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C24H30N4O3S/c1-26(16-19-10-12-20(13-11-19)27-14-6-3-7-15-27)24(29)17-28-22-9-5-4-8-21(22)25-23(28)18-32(2,30)31/h4-5,8-13H,3,6-7,14-18H2,1-2H3 |
| InChIKey | VFSBDRVJBZZGAM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|