C22H19FN2O3S — CID 55608765
5-(2-fluorophenyl)-N-[2-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 55608765) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[2-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[2-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55608765 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[2-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCOCC1)c1ccc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C22H19FN2O3S/c23-17-7-3-1-5-15(17)19-9-10-20(29-19)21(26)24-18-8-4-2-6-16(18)22(27)25-11-13-28-14-12-25/h1-10H,11-14H2,(H,24,26) |
| InChIKey | MMUUDZFGPMJEBO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |