C25H26FN3O3S — CID 55610507
N-(4-cyclopentylsulfonylphenyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide (PubChem CID 55610507) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55610507 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C=CC(=O)Nc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C25H26FN3O3S/c1-17-24(18(2)29(28-17)21-11-7-19(26)8-12-21)15-16-25(30)27-20-9-13-23(14-10-20)33(31,32)22-5-3-4-6-22/h7-16,22H,3-6H2,1-2H3,(H,27,30) |
| InChIKey | HVQQZBJHJSIELY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|