C18H20FN3O3S — CID 55429860
(E)-N-(1,1-dioxothiolan-3-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide (PubChem CID 55429860) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55429860 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C/C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20FN3O3S/c1-12-17(7-8-18(23)20-15-9-10-26(24,25)11-15)13(2)22(21-12)16-5-3-14(19)4-6-16/h3-8,15H,9-11H2,1-2H3,(H,20,23)/b8-7+ |
| InChIKey | LGLIATIGDZHMTM-BQYQJAHWSA-N |
| XLogP | 1.94 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|