C25H29N4O+ — CID 9488536
(E)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 9488536) has the molecular formula C25H29N4O+ and a molecular weight of 401.53 g/mol. Its IUPAC name is (E)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9488536 |
| Molecular Formula | C25H29N4O+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (E)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N[C@H]1CC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H28N4O/c1-19-24(20(2)29(27-19)23-11-7-4-8-12-23)13-14-25(30)26-22-15-16-28(18-22)17-21-9-5-3-6-10-21/h3-14,22H,15-18H2,1-2H3,(H,26,30)/p+1/b14-13+/t22-/m0/s1 |
| InChIKey | SAVGMNBRYMVNAS-TWLJRWAQSA-O |
| XLogP | 2.48 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|