C23H28N4O5 — CID 55620651
methyl 3-[3-(4-methyl-2-phenylpiperazin-1-yl)propylcarbamoyl]-5-nitrobenzoate (PubChem CID 55620651) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 3-[3-(4-methyl-2-phenylpiperazin-1-yl)propylcarbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[3-(4-methyl-2-phenylpiperazin-1-yl)propylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 55620651 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | methyl 3-[3-(4-methyl-2-phenylpiperazin-1-yl)propylcarbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NCCCN2CCN(C)CC2c2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N4O5/c1-25-11-12-26(21(16-25)17-7-4-3-5-8-17)10-6-9-24-22(28)18-13-19(23(29)32-2)15-20(14-18)27(30)31/h3-5,7-8,13-15,21H,6,9-12,16H2,1-2H3,(H,24,28) |
| InChIKey | MUGQZURWNYRHBR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|