C24H23N5O3 — CID 55622235
N-[4-[[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 55622235) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[4-[[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[4-[[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 55622235 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[4-[[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)Nc1ccc(NC(=O)C(C)n2cncn2)cc1 |
| InChI | InChI=1S/C24H23N5O3/c1-3-21-20(19-6-4-5-7-22(19)32-21)12-13-23(30)27-17-8-10-18(11-9-17)28-24(31)16(2)29-15-25-14-26-29/h4-16H,3H2,1-2H3,(H,27,30)(H,28,31)/b13-12+ |
| InChIKey | RJLIVTHQMFWCCZ-OUKQBFOZSA-N |
| XLogP | 4.44 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|