C22H21N3O4 — CID 55626989
1-[[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]-6-methoxyindole-2,3-dione (PubChem CID 55626989) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]-6-methoxyindole-2,3-dione.
| Compound Name | 1-[[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]-6-methoxyindole-2,3-dione |
|---|---|
| PubChem CID | 55626989 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]-6-methoxyindole-2,3-dione |
| SMILES | COc1ccc2c(c1)N(CN1CCC(c3nc4ccccc4o3)CC1)C(=O)C2=O |
| InChI | InChI=1S/C22H21N3O4/c1-28-15-6-7-16-18(12-15)25(22(27)20(16)26)13-24-10-8-14(9-11-24)21-23-17-4-2-3-5-19(17)29-21/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | DYLLOBGRJCCPOB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|