C23H30ClN3O2 — CID 55629625
1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]urea (PubChem CID 55629625) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55629625 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]urea |
| SMILES | CCOCc1ccccc1CNC(=O)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-2-29-17-20-6-4-3-5-19(20)15-25-23(28)26-22-11-13-27(14-12-22)16-18-7-9-21(24)10-8-18/h3-10,22H,2,11-17H2,1H3,(H2,25,26,28) |
| InChIKey | IRXQACMZMQKBMH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |