C19H12F4N4O3 — CID 55630701
1-(4-fluorophenyl)-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyridazine-3-carboxamide (PubChem CID 55630701) has the molecular formula C19H12F4N4O3 and a molecular weight of 420.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyridazine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55630701 |
| Molecular Formula | C19H12F4N4O3 |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-(4-fluorophenyl)-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyridazine-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(=O)n(-c2ccc(F)cc2)n1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H12F4N4O3/c20-10-1-3-11(4-2-10)27-16(29)8-7-14(26-27)19(30)24-9-15(28)25-13-6-5-12(21)17(22)18(13)23/h1-8H,9H2,(H,24,30)(H,25,28) |
| InChIKey | QBACNPJAGSKHGF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|