C19H15ClFN3O2S — CID 55633633
N-[2-(4-chlorophenyl)sulfanylethyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 55633633) has the molecular formula C19H15ClFN3O2S and a molecular weight of 403.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55633633 |
| Molecular Formula | C19H15ClFN3O2S |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)c1ccc(=O)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H15ClFN3O2S/c20-13-1-7-16(8-2-13)27-12-11-22-19(26)17-9-10-18(25)24(23-17)15-5-3-14(21)4-6-15/h1-10H,11-12H2,(H,22,26) |
| InChIKey | ZAONLYPYSWEKQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|