C19H21BrN2O2 — CID 55631668
6-(3-bromophenyl)-2-methyl-N-[2-(oxolan-2-yl)ethyl]pyridine-3-carboxamide (PubChem CID 55631668) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 6-(3-bromophenyl)-2-methyl-N-[2-(oxolan-2-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-(3-bromophenyl)-2-methyl-N-[2-(oxolan-2-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55631668 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 6-(3-bromophenyl)-2-methyl-N-[2-(oxolan-2-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccc(Br)c2)ccc1C(=O)NCCC1CCCO1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-13-17(19(23)21-10-9-16-6-3-11-24-16)7-8-18(22-13)14-4-2-5-15(20)12-14/h2,4-5,7-8,12,16H,3,6,9-11H2,1H3,(H,21,23) |
| InChIKey | LEQSGPLXLGNCBU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |