C20H26N4O2 — CID 122556166
3-[6-(methylamino)pyridazin-3-yl]-N-[4-(oxolan-2-yl)butyl]benzamide (PubChem CID 122556166) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[6-(methylamino)pyridazin-3-yl]-N-[4-(oxolan-2-yl)butyl]benzamide.
| Compound Name | 3-[6-(methylamino)pyridazin-3-yl]-N-[4-(oxolan-2-yl)butyl]benzamide |
|---|---|
| PubChem CID | 122556166 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 3-[6-(methylamino)pyridazin-3-yl]-N-[4-(oxolan-2-yl)butyl]benzamide |
| SMILES | CNc1ccc(-c2cccc(C(=O)NCCCCC3CCCO3)c2)nn1 |
| InChI | InChI=1S/C20H26N4O2/c1-21-19-11-10-18(23-24-19)15-6-4-7-16(14-15)20(25)22-12-3-2-8-17-9-5-13-26-17/h4,6-7,10-11,14,17H,2-3,5,8-9,12-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | CHHUNGKFRVJJBC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|