C20H23FN2O2 — CID 126450624
3-(3-fluoro-2-pyridinyl)-N-[4-[(2S)-oxolan-2-yl]butyl]benzamide (PubChem CID 126450624) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 3-(3-fluoro-2-pyridinyl)-N-[4-[(2S)-oxolan-2-yl]butyl]benzamide.
| Compound Name | 3-(3-fluoro-2-pyridinyl)-N-[4-[(2S)-oxolan-2-yl]butyl]benzamide |
|---|---|
| PubChem CID | 126450624 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-(3-fluoro-2-pyridinyl)-N-[4-[(2S)-oxolan-2-yl]butyl]benzamide |
| SMILES | O=C(NCCCC[C@H]1CCCO1)c1cccc(-c2ncccc2F)c1 |
| InChI | InChI=1S/C20H23FN2O2/c21-18-10-4-12-22-19(18)15-6-3-7-16(14-15)20(24)23-11-2-1-8-17-9-5-13-25-17/h3-4,6-7,10,12,14,17H,1-2,5,8-9,11,13H2,(H,23,24)/t17-/m0/s1 |
| InChIKey | SPNIKYULFVUWLK-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|