C21H24FNO3 — CID 118788734
3-(3-fluoro-2-hydroxyphenyl)-N-[4-(oxolan-2-yl)butyl]benzamide (PubChem CID 118788734) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(3-fluoro-2-hydroxyphenyl)-N-[4-(oxolan-2-yl)butyl]benzamide.
| Compound Name | 3-(3-fluoro-2-hydroxyphenyl)-N-[4-(oxolan-2-yl)butyl]benzamide |
|---|---|
| PubChem CID | 118788734 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-(3-fluoro-2-hydroxyphenyl)-N-[4-(oxolan-2-yl)butyl]benzamide |
| SMILES | O=C(NCCCCC1CCCO1)c1cccc(-c2cccc(F)c2O)c1 |
| InChI | InChI=1S/C21H24FNO3/c22-19-11-4-10-18(20(19)24)15-6-3-7-16(14-15)21(25)23-12-2-1-8-17-9-5-13-26-17/h3-4,6-7,10-11,14,17,24H,1-2,5,8-9,12-13H2,(H,23,25) |
| InChIKey | JHIBLBOJODYMSR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|