C26H33N3O7 — CID 55632889
N-(2-nitro-4,5-dipropoxyphenyl)-1-(2-phenoxyacetyl)piperidine-4-carboxamide (PubChem CID 55632889) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is N-(2-nitro-4,5-dipropoxyphenyl)-1-(2-phenoxyacetyl)piperidine-4-carboxamide.
| Compound Name | N-(2-nitro-4,5-dipropoxyphenyl)-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55632889 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N-(2-nitro-4,5-dipropoxyphenyl)-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
| SMILES | CCCOc1cc(NC(=O)C2CCN(C(=O)COc3ccccc3)CC2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C26H33N3O7/c1-3-14-34-23-16-21(22(29(32)33)17-24(23)35-15-4-2)27-26(31)19-10-12-28(13-11-19)25(30)18-36-20-8-6-5-7-9-20/h5-9,16-17,19H,3-4,10-15,18H2,1-2H3,(H,27,31) |
| InChIKey | DWYQDUOUEUIPEL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|