C21H23BrN4OS — CID 55635346
[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone (PubChem CID 55635346) has the molecular formula C21H23BrN4OS and a molecular weight of 459.41 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 55635346 |
| Molecular Formula | C21H23BrN4OS |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3ccc(Br)s3)CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C21H23BrN4OS/c1-15-13-18(16(2)26(15)20-5-3-4-8-23-20)21(27)25-11-9-24(10-12-25)14-17-6-7-19(22)28-17/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | QLLDGSLMWLOLGK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|