C20H19N3O5S — CID 55635506
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide (PubChem CID 55635506) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 55635506 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide |
| SMILES | COCCOc1ccc(NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)cn1 |
| InChI | InChI=1S/C20H19N3O5S/c1-27-10-11-28-19-9-8-15(12-21-19)22-18(24)13-23-16-6-2-4-14-5-3-7-17(20(14)16)29(23,25)26/h2-9,12H,10-11,13H2,1H3,(H,22,24) |
| InChIKey | UMRWREFYGAWGAU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|