C16H21N5O5S3 — CID 55637777
ethyl N-[5-[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55637777) has the molecular formula C16H21N5O5S3 and a molecular weight of 459.58 g/mol. Its IUPAC name is ethyl N-[5-[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55637777 |
| Molecular Formula | C16H21N5O5S3 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | ethyl N-[5-[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SC(C)C(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)s1 |
| InChI | InChI=1S/C16H21N5O5S3/c1-5-26-15(23)18-14-19-20-16(28-14)27-10(2)13(22)17-11-7-6-8-12(9-11)29(24,25)21(3)4/h6-10H,5H2,1-4H3,(H,17,22)(H,18,19,23) |
| InChIKey | NNJUCCOQIGUOJY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|