C23H21F2N3O3 — CID 55638881
ethyl (E)-3-[4-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]phenyl]prop-2-enoate (PubChem CID 55638881) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55638881 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl (E)-3-[4-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)c2c(C)nn(-c3ccc(F)cc3F)c2C)cc1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-4-31-21(29)12-7-16-5-9-18(10-6-16)26-23(30)22-14(2)27-28(15(22)3)20-11-8-17(24)13-19(20)25/h5-13H,4H2,1-3H3,(H,26,30)/b12-7+ |
| InChIKey | ILTVHYUIAJZMQB-KPKJPENVSA-N |
| XLogP | 4.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|