C17H20BrNO4S — CID 55638935
N-(3-bromo-4-methylphenyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide (PubChem CID 55638935) has the molecular formula C17H20BrNO4S and a molecular weight of 414.32 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55638935 |
| Molecular Formula | C17H20BrNO4S |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)Nc2ccc(C)c(Br)c2)cc1C |
| InChI | InChI=1S/C17H20BrNO4S/c1-12-4-5-14(11-16(12)18)19-24(20,21)15-6-7-17(13(2)10-15)23-9-8-22-3/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | MVDBCJZKQTXIRF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|