C17H19F3N2O4 — CID 55640942
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 55640942) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55640942 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | CC(C)N1CC(C(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C17H19F3N2O4/c1-10(2)22-8-11(7-15(22)24)16(25)26-9-14(23)21-13-5-3-12(4-6-13)17(18,19)20/h3-6,10-11H,7-9H2,1-2H3,(H,21,23) |
| InChIKey | GZERAZWXMSYYFW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |