C24H22N2O6 — CID 55640731
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 55640731) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55640731 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 5-oxo-1-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | CC(C)N1CC(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1=O |
| InChI | InChI=1S/C24H22N2O6/c1-13(2)26-11-14(9-21(26)28)24(31)32-12-20(27)25-15-7-8-18-19(10-15)23(30)17-6-4-3-5-16(17)22(18)29/h3-8,10,13-14H,9,11-12H2,1-2H3,(H,25,27) |
| InChIKey | GQFATPHOCAVFFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|