C18H22F3N3O2 — CID 55641669
5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide (PubChem CID 55641669) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55641669 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)C1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C18H22F3N3O2/c19-18(20,21)14-6-1-2-7-15(14)23-17(26)12-9-16(25)24(10-12)11-13-5-3-4-8-22-13/h3-5,8,12,14-15H,1-2,6-7,9-11H2,(H,23,26) |
| InChIKey | SVTPYHMXCXEBSO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |