C17H20N6O2 — CID 94125432
(3R)-5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide (PubChem CID 94125432) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is (3R)-5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94125432 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3R)-5-oxo-1-(pyridin-2-ylmethyl)-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)[C@@H]1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C17H20N6O2/c24-15-10-13(11-23(15)12-14-4-1-2-5-18-14)16(25)19-8-9-22-17-20-6-3-7-21-17/h1-7,13H,8-12H2,(H,19,25)(H,20,21,22)/t13-/m1/s1 |
| InChIKey | QXKFLSNWHGJTLC-CYBMUJFWSA-N |
| XLogP | 0.45 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|