C19H20FN3O3 — CID 72919255
N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 72919255) has the molecular formula C19H20FN3O3 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 72919255 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1F)C1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C19H20FN3O3/c20-16-6-1-2-7-17(16)26-10-9-22-19(25)14-11-18(24)23(12-14)13-15-5-3-4-8-21-15/h1-8,14H,9-13H2,(H,22,25) |
| InChIKey | ZMCOSHQFEBQPEW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|