C17H15F3N6O — CID 55642801
N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 55642801) has the molecular formula C17H15F3N6O and a molecular weight of 376.34 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55642801 |
| Molecular Formula | C17H15F3N6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(-n3cnnn3)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N6O/c1-25(2)12-6-7-15(14(9-12)17(18,19)20)22-16(27)11-4-3-5-13(8-11)26-10-21-23-24-26/h3-10H,1-2H3,(H,22,27) |
| InChIKey | UKNMJPCQKVSIND-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |