C20H23FN2O4 — CID 55644894
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 55644894) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 55644894 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | O=C(COC(=O)C1CC(c2cccc(F)c2)=NO1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H23FN2O4/c21-16-8-4-7-15(11-16)17-12-18(27-23-17)20(25)26-13-19(24)22-10-9-14-5-2-1-3-6-14/h4-5,7-8,11,18H,1-3,6,9-10,12-13H2,(H,22,24) |
| InChIKey | QXSWXNQKDITTFJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|