C22H28N2O2 — CID 55645284
N-(1-benzylpiperidin-3-yl)-2-(4-methylphenoxy)propanamide (PubChem CID 55645284) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-2-(4-methylphenoxy)propanamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-2-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 55645284 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-2-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)NC2CCCN(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-17-10-12-21(13-11-17)26-18(2)22(25)23-20-9-6-14-24(16-20)15-19-7-4-3-5-8-19/h3-5,7-8,10-13,18,20H,6,9,14-16H2,1-2H3,(H,23,25) |
| InChIKey | TXZPUOQUAHMDGQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |