C18H15N7O2S — CID 55651820
N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55651820) has the molecular formula C18H15N7O2S and a molecular weight of 393.43 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55651820 |
| Molecular Formula | C18H15N7O2S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)Cc3ccc(-n4cnnn4)cc3)sc2c1 |
| InChI | InChI=1S/C18H15N7O2S/c1-11(26)20-13-4-7-15-16(9-13)28-18(21-15)22-17(27)8-12-2-5-14(6-3-12)25-10-19-23-24-25/h2-7,9-10H,8H2,1H3,(H,20,26)(H,21,22,27) |
| InChIKey | SECYHRUFQLTGDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |